C19H17ClN2O5 — CID 33240471
[2-oxo-2-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)ethyl] 2-chloropyridine-4-carboxylate (PubChem CID 33240471) has the molecular formula C19H17ClN2O5 and a molecular weight of 388.81 g/mol. Its IUPAC name is [2-oxo-2-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)ethyl] 2-chloropyridine-4-carboxylate.
| Compound Name | [2-oxo-2-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)ethyl] 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 33240471 |
| Molecular Formula | C19H17ClN2O5 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [2-oxo-2-(spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylamino)ethyl] 2-chloropyridine-4-carboxylate |
| SMILES | O=C(COC(=O)c1ccnc(Cl)c1)Nc1ccc2c(c1)OC1(CCCC1)O2 |
| InChI | InChI=1S/C19H17ClN2O5/c20-16-9-12(5-8-21-16)18(24)25-11-17(23)22-13-3-4-14-15(10-13)27-19(26-14)6-1-2-7-19/h3-5,8-10H,1-2,6-7,11H2,(H,22,23) |
| InChIKey | MFHHOIGBKVAHES-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|