C15H12F2N2O5S — CID 2515189
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2,6-difluorobenzoate (PubChem CID 2515189) has the molecular formula C15H12F2N2O5S and a molecular weight of 370.33 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2,6-difluorobenzoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 2515189 |
| Molecular Formula | C15H12F2N2O5S |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2,6-difluorobenzoate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C15H12F2N2O5S/c16-11-2-1-3-12(17)14(11)15(21)24-8-13(20)19-9-4-6-10(7-5-9)25(18,22)23/h1-7H,8H2,(H,19,20)(H2,18,22,23) |
| InChIKey | SNLPERNXAZEZOO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |