C19H18ClFN2O5S — CID 2501169
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-chloro-6-fluorobenzoate (PubChem CID 2501169) has the molecular formula C19H18ClFN2O5S and a molecular weight of 440.88 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-chloro-6-fluorobenzoate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 2501169 |
| Molecular Formula | C19H18ClFN2O5S |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylanilino)ethyl] 2-chloro-6-fluorobenzoate |
| SMILES | O=C(COC(=O)c1c(F)cccc1Cl)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H18ClFN2O5S/c20-15-4-3-5-16(21)18(15)19(25)28-12-17(24)22-13-6-8-14(9-7-13)29(26,27)23-10-1-2-11-23/h3-9H,1-2,10-12H2,(H,22,24) |
| InChIKey | ZOBYDLPKAMXIBI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |