C15H12Cl3N3O3 — CID 2379405
[2-(4-methylanilino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 2379405) has the molecular formula C15H12Cl3N3O3 and a molecular weight of 388.64 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [2-(4-methylanilino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 2379405 |
| Molecular Formula | C15H12Cl3N3O3 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | [2-(4-methylanilino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl3N3O3/c1-7-2-4-8(5-3-7)20-9(22)6-24-15(23)13-10(16)12(19)11(17)14(18)21-13/h2-5H,6H2,1H3,(H2,19,21)(H,20,22) |
| InChIKey | KXUJXEIUACAABA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|