C12H14Cl3N3O3 — CID 4002610
[2-(butan-2-ylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 4002610) has the molecular formula C12H14Cl3N3O3 and a molecular weight of 354.62 g/mol. Its IUPAC name is [2-(butan-2-ylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [2-(butan-2-ylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 4002610 |
| Molecular Formula | C12H14Cl3N3O3 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | [2-(butan-2-ylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | CCC(C)NC(=O)COC(=O)c1nc(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C12H14Cl3N3O3/c1-3-5(2)17-6(19)4-21-12(20)10-7(13)9(16)8(14)11(15)18-10/h5H,3-4H2,1-2H3,(H2,16,18)(H,17,19) |
| InChIKey | SYCBLGHQKIQFTF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|