C11H12Cl3N3O4 — CID 7633614
[2-(2-methoxyethylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 7633614) has the molecular formula C11H12Cl3N3O4 and a molecular weight of 356.59 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7633614 |
| Molecular Formula | C11H12Cl3N3O4 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | COCCNC(=O)COC(=O)c1nc(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C11H12Cl3N3O4/c1-20-3-2-16-5(18)4-21-11(19)9-6(12)8(15)7(13)10(14)17-9/h2-4H2,1H3,(H2,15,17)(H,16,18) |
| InChIKey | QKUCREPFZCRUER-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|