C9H9Cl3N2O2 — CID 3090753
propyl 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 3090753) has the molecular formula C9H9Cl3N2O2 and a molecular weight of 283.54 g/mol. Its IUPAC name is propyl 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | propyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 3090753 |
| Molecular Formula | C9H9Cl3N2O2 |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 281.97 |
| IUPAC Name | propyl 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | CCCOC(=O)c1nc(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C9H9Cl3N2O2/c1-2-3-16-9(15)7-4(10)6(13)5(11)8(12)14-7/h2-3H2,1H3,(H2,13,14) |
| InChIKey | NYCTWTAPFOBVGG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|