C13H15Cl3N4O4 — CID 5238801
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 5238801) has the molecular formula C13H15Cl3N4O4 and a molecular weight of 397.65 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 5238801 |
| Molecular Formula | C13H15Cl3N4O4 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)c1nc(Cl)c(Cl)c(N)c1Cl |
| InChI | InChI=1S/C13H15Cl3N4O4/c1-13(2,3)20-12(23)18-5(21)4-24-11(22)9-6(14)8(17)7(15)10(16)19-9/h4H2,1-3H3,(H2,17,19)(H2,18,20,21,23) |
| InChIKey | DKQVULGWMLSUJG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|