C15H11Cl3N4O6 — CID 3351194
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate (PubChem CID 3351194) has the molecular formula C15H11Cl3N4O6 and a molecular weight of 449.63 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 3351194 |
| Molecular Formula | C15H11Cl3N4O6 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-amino-3,5,6-trichloropyridine-2-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2nc(Cl)c(Cl)c(N)c2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11Cl3N4O6/c1-27-6-2-3-7(8(4-6)22(25)26)20-9(23)5-28-15(24)13-10(16)12(19)11(17)14(18)21-13/h2-4H,5H2,1H3,(H2,19,21)(H,20,23) |
| InChIKey | GLEMCLIQNPVXDE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|