C24H18N4O7 — CID 42964720
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate (PubChem CID 42964720) has the molecular formula C24H18N4O7 and a molecular weight of 474.43 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 42964720 |
| Molecular Formula | C24H18N4O7 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2nn(-c3ccccc3)c(=O)c3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18N4O7/c1-34-16-11-12-19(20(13-16)28(32)33)25-21(29)14-35-24(31)22-17-9-5-6-10-18(17)23(30)27(26-22)15-7-3-2-4-8-15/h2-13H,14H2,1H3,(H,25,29) |
| InChIKey | KBPXXAMBIKKSTA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|