C20H19N3O5 — CID 2588323
[2-(2-methoxyethylamino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate (PubChem CID 2588323) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2588323 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate |
| SMILES | COCCNC(=O)COC(=O)c1nn(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H19N3O5/c1-27-12-11-21-17(24)13-28-20(26)18-15-9-5-6-10-16(15)19(25)23(22-18)14-7-3-2-4-8-14/h2-10H,11-13H2,1H3,(H,21,24) |
| InChIKey | RKWGFESAXGLBKY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|