C17H14N2O3 — CID 12695680
ethyl 4-oxo-3-phenylphthalazine-1-carboxylate (PubChem CID 12695680) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is ethyl 4-oxo-3-phenylphthalazine-1-carboxylate.
| Compound Name | ethyl 4-oxo-3-phenylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 12695680 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | ethyl 4-oxo-3-phenylphthalazine-1-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H14N2O3/c1-2-22-17(21)15-13-10-6-7-11-14(13)16(20)19(18-15)12-8-4-3-5-9-12/h3-11H,2H2,1H3 |
| InChIKey | KDBSMWPTBXYFIC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |