C21H16N4O4 — CID 3430058
(4-amino-3-cyano-2-oxopent-3-enyl) 4-oxo-3-phenylphthalazine-1-carboxylate (PubChem CID 3430058) has the molecular formula C21H16N4O4 and a molecular weight of 388.38 g/mol. Its IUPAC name is (4-amino-3-cyano-2-oxopent-3-enyl) 4-oxo-3-phenylphthalazine-1-carboxylate.
| Compound Name | (4-amino-3-cyano-2-oxopent-3-enyl) 4-oxo-3-phenylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 3430058 |
| Molecular Formula | C21H16N4O4 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (4-amino-3-cyano-2-oxopent-3-enyl) 4-oxo-3-phenylphthalazine-1-carboxylate |
| SMILES | CC(N)=C(C#N)C(=O)COC(=O)c1nn(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H16N4O4/c1-13(23)17(11-22)18(26)12-29-21(28)19-15-9-5-6-10-16(15)20(27)25(24-19)14-7-3-2-4-8-14/h2-10H,12,23H2,1H3 |
| InChIKey | UQCPNGCQHMOTCM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 128.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|