C22H16F3N5O3 — CID 4831219
(4-amino-3-cyano-2-oxopent-3-enyl) 5-phenyl-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxylate (PubChem CID 4831219) has the molecular formula C22H16F3N5O3 and a molecular weight of 455.40 g/mol. Its IUPAC name is (4-amino-3-cyano-2-oxopent-3-enyl) 5-phenyl-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxylate.
| Compound Name | (4-amino-3-cyano-2-oxopent-3-enyl) 5-phenyl-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 4831219 |
| Molecular Formula | C22H16F3N5O3 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (4-amino-3-cyano-2-oxopent-3-enyl) 5-phenyl-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazole-3-carboxylate |
| SMILES | CC(N)=C(C#N)C(=O)COC(=O)c1nc(-c2ccccc2)n(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C22H16F3N5O3/c1-13(27)17(11-26)18(31)12-33-21(32)19-28-20(14-6-3-2-4-7-14)30(29-19)16-9-5-8-15(10-16)22(23,24)25/h2-10H,12,27H2,1H3 |
| InChIKey | WJRCPYIFYURSMY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 123.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|