C15H10F3N3O3 — CID 7613597
cyanomethyl 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate (PubChem CID 7613597) has the molecular formula C15H10F3N3O3 and a molecular weight of 337.26 g/mol. Its IUPAC name is cyanomethyl 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate.
| Compound Name | cyanomethyl 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 7613597 |
| Molecular Formula | C15H10F3N3O3 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | cyanomethyl 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate |
| SMILES | Cc1cc(=O)c(C(=O)OCC#N)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10F3N3O3/c1-9-7-12(22)13(14(23)24-6-5-19)20-21(9)11-4-2-3-10(8-11)15(16,17)18/h2-4,7-8H,6H2,1H3 |
| InChIKey | SJUWALDMCOYOLQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |