C21H17F3N2O3 — CID 9063337
[(1S)-1-phenylethyl] 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate (PubChem CID 9063337) has the molecular formula C21H17F3N2O3 and a molecular weight of 402.37 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate.
| Compound Name | [(1S)-1-phenylethyl] 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 9063337 |
| Molecular Formula | C21H17F3N2O3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [(1S)-1-phenylethyl] 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate |
| SMILES | Cc1cc(=O)c(C(=O)O[C@@H](C)c2ccccc2)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17F3N2O3/c1-13-11-18(27)19(20(28)29-14(2)15-7-4-3-5-8-15)25-26(13)17-10-6-9-16(12-17)21(22,23)24/h3-12,14H,1-2H3/t14-/m0/s1 |
| InChIKey | GZRGIXDFZIPFRO-AWEZNQCLSA-N |
| XLogP | 4.48 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |