C20H14F3N3O5 — CID 27971219
(3-nitrophenyl)methyl 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate (PubChem CID 27971219) has the molecular formula C20H14F3N3O5 and a molecular weight of 433.34 g/mol. Its IUPAC name is (3-nitrophenyl)methyl 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate.
| Compound Name | (3-nitrophenyl)methyl 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 27971219 |
| Molecular Formula | C20H14F3N3O5 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (3-nitrophenyl)methyl 6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxylate |
| SMILES | Cc1cc(=O)c(C(=O)OCc2cccc([N+](=O)[O-])c2)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H14F3N3O5/c1-12-8-17(27)18(19(28)31-11-13-4-2-7-16(9-13)26(29)30)24-25(12)15-6-3-5-14(10-15)20(21,22)23/h2-10H,11H2,1H3 |
| InChIKey | JILDMWGCKMWXAR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|