C27H19N5O4 — CID 135614457
[(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 4-oxo-3-phenylphthalazine-1-carboxylate (PubChem CID 135614457) has the molecular formula C27H19N5O4 and a molecular weight of 477.48 g/mol. Its IUPAC name is [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 4-oxo-3-phenylphthalazine-1-carboxylate.
| Compound Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 4-oxo-3-phenylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 135614457 |
| Molecular Formula | C27H19N5O4 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 4-oxo-3-phenylphthalazine-1-carboxylate |
| SMILES | Cn1c(/C(C#N)=C(\O)COC(=O)c2nn(-c3ccccc3)c(=O)c3ccccc23)nc2ccccc21 |
| InChI | InChI=1S/C27H19N5O4/c1-31-22-14-8-7-13-21(22)29-25(31)20(15-28)23(33)16-36-27(35)24-18-11-5-6-12-19(18)26(34)32(30-24)17-9-3-2-4-10-17/h2-14,33H,16H2,1H3/b23-20- |
| InChIKey | RUSKOSNFVFHCBM-ATJXCDBQSA-N |
| XLogP | 3.92 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|