C19H13Cl2N3O3 — CID 135550399
[(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 2,4-dichlorobenzoate (PubChem CID 135550399) has the molecular formula C19H13Cl2N3O3 and a molecular weight of 402.24 g/mol. Its IUPAC name is [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 2,4-dichlorobenzoate.
| Compound Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 135550399 |
| Molecular Formula | C19H13Cl2N3O3 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 2,4-dichlorobenzoate |
| SMILES | Cn1c(/C(C#N)=C(\O)COC(=O)c2ccc(Cl)cc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C19H13Cl2N3O3/c1-24-16-5-3-2-4-15(16)23-18(24)13(9-22)17(25)10-27-19(26)12-7-6-11(20)8-14(12)21/h2-8,25H,10H2,1H3/b17-13- |
| InChIKey | MUWGCKUVOQMDPO-LGMDPLHJSA-N |
| XLogP | 4.53 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|