C24H25N3O3 — CID 135774609
[(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] (2R,3S)-3-methyl-2-phenylpentanoate (PubChem CID 135774609) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] (2R,3S)-3-methyl-2-phenylpentanoate.
| Compound Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] (2R,3S)-3-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 135774609 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] (2R,3S)-3-methyl-2-phenylpentanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC/C(O)=C(\C#N)c1nc2ccccc2n1C)c1ccccc1 |
| InChI | InChI=1S/C24H25N3O3/c1-4-16(2)22(17-10-6-5-7-11-17)24(29)30-15-21(28)18(14-25)23-26-19-12-8-9-13-20(19)27(23)3/h5-13,16,22,28H,4,15H2,1-3H3/b21-18-/t16-,22+/m0/s1 |
| InChIKey | CKDYJQZBCQQBLH-SGBAJBTKSA-N |
| XLogP | 4.74 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|