C20H17N3O4 — CID 135665430
[(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 2-hydroxy-3-methylbenzoate (PubChem CID 135665430) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 2-hydroxy-3-methylbenzoate.
| Compound Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 135665430 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | [(Z)-3-cyano-2-hydroxy-3-(1-methylbenzimidazol-2-yl)prop-2-enyl] 2-hydroxy-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OC/C(O)=C(\C#N)c2nc3ccccc3n2C)c1O |
| InChI | InChI=1S/C20H17N3O4/c1-12-6-5-7-13(18(12)25)20(26)27-11-17(24)14(10-21)19-22-15-8-3-4-9-16(15)23(19)2/h3-9,24-25H,11H2,1-2H3/b17-14- |
| InChIKey | LGFBAAXGDXFDHU-VKAVYKQESA-N |
| XLogP | 3.24 |
| TPSA | 108.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|