About (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate
(4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate (PubChem CID 42965873) has the molecular formula C25H20N2O4
and a molecular weight of 412.45 g/mol. Its IUPAC name is (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate.
Molecular Properties
| Compound Name | (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate |
| PubChem CID | 42965873 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate |
| SMILES | O=C(CCCOC(=O)c1nn(-c2ccccc2)c(=O)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C25H20N2O4/c28-22(18-10-3-1-4-11-18)16-9-17-31-25(30)23-20-14-7-8-15-21(20)24(29)27(26-23)19-12-5-2-6-13-19/h1-8,10-15H,9,16-17H2 |
| InChIKey | UUTLDSDTLFJSME-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate?
The IUPAC name of (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate (CID 42965873) is (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate.
What is the SMILES notation for (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate?
The canonical SMILES for (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate is O=C(CCCOC(=O)c1nn(-c2ccccc2)c(=O)c2ccccc12)c1ccccc1.
What is the InChIKey of (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate?
The InChIKey is UUTLDSDTLFJSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O4/c28-22(18-10-3-1-4-11-18)16-9-17-31-25(30)23-20-14-7-8-15-21(20)24(29)27(26-23)19-12-5-2-6-13-19/h1-8,10-15H,9,16-17H2.
What are the key properties of (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate?
(4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate has a molecular weight of 412.45 g/mol, XLogP of 4.21, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-4-phenylbutyl) 4-oxo-3-phenylphthalazine-1-carboxylate is sourced from PubChem (CID 42965873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).