C24H25N3O4 — CID 2588400
[2-(cyclohexylmethylamino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate (PubChem CID 2588400) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2588400 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 4-oxo-3-phenylphthalazine-1-carboxylate |
| SMILES | O=C(COC(=O)c1nn(-c2ccccc2)c(=O)c2ccccc12)NCC1CCCCC1 |
| InChI | InChI=1S/C24H25N3O4/c28-21(25-15-17-9-3-1-4-10-17)16-31-24(30)22-19-13-7-8-14-20(19)23(29)27(26-22)18-11-5-2-6-12-18/h2,5-8,11-14,17H,1,3-4,9-10,15-16H2,(H,25,28) |
| InChIKey | QFNBOXXRVHTKOR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |