C18H20N4O6 — CID 33126295
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate (PubChem CID 33126295) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate |
|---|---|
| PubChem CID | 33126295 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)c1nn(-c2ccccc2)c(C)cc1=O |
| InChI | InChI=1S/C18H20N4O6/c1-12-10-14(23)16(21-22(12)13-6-4-3-5-7-13)17(25)28-11-15(24)20-18(26)19-8-9-27-2/h3-7,10H,8-9,11H2,1-2H3,(H2,19,20,24,26) |
| InChIKey | WDJMKJFXKSTFDD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|