C20H17N3O4 — CID 33124998
(2-anilino-2-oxoethyl) 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate (PubChem CID 33124998) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate.
| Compound Name | (2-anilino-2-oxoethyl) 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate |
|---|---|
| PubChem CID | 33124998 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (2-anilino-2-oxoethyl) 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate |
| SMILES | Cc1cc(=O)c(C(=O)OCC(=O)Nc2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C20H17N3O4/c1-14-12-17(24)19(22-23(14)16-10-6-3-7-11-16)20(26)27-13-18(25)21-15-8-4-2-5-9-15/h2-12H,13H2,1H3,(H,21,25) |
| InChIKey | AXXMTDYESIMXKB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |