C26H21N3O4 — CID 33125444
[2-oxo-2-(4-phenylanilino)ethyl] 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate (PubChem CID 33125444) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylanilino)ethyl] 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate.
| Compound Name | [2-oxo-2-(4-phenylanilino)ethyl] 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate |
|---|---|
| PubChem CID | 33125444 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [2-oxo-2-(4-phenylanilino)ethyl] 6-methyl-4-oxo-1-phenylpyridazine-3-carboxylate |
| SMILES | Cc1cc(=O)c(C(=O)OCC(=O)Nc2ccc(-c3ccccc3)cc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C26H21N3O4/c1-18-16-23(30)25(28-29(18)22-10-6-3-7-11-22)26(32)33-17-24(31)27-21-14-12-20(13-15-21)19-8-4-2-5-9-19/h2-16H,17H2,1H3,(H,27,31) |
| InChIKey | BSPGMPDTQZFREM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |