C23H19N3O4 — CID 2083465
N-(2,5-dimethoxyphenyl)-4-oxo-3-phenylphthalazine-1-carboxamide (PubChem CID 2083465) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-oxo-3-phenylphthalazine-1-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-oxo-3-phenylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 2083465 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-oxo-3-phenylphthalazine-1-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2nn(-c3ccccc3)c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C23H19N3O4/c1-29-16-12-13-20(30-2)19(14-16)24-22(27)21-17-10-6-7-11-18(17)23(28)26(25-21)15-8-4-3-5-9-15/h3-14H,1-2H3,(H,24,27) |
| InChIKey | WKOLCEOIIVGRAL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |