C21H17N4O3+ — CID 4253119
3-(4-methoxyphenyl)-4-oxo-N-pyridin-1-ium-2-ylphthalazine-1-carboxamide (PubChem CID 4253119) has the molecular formula C21H17N4O3+ and a molecular weight of 373.39 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-oxo-N-pyridin-1-ium-2-ylphthalazine-1-carboxamide.
| Compound Name | 3-(4-methoxyphenyl)-4-oxo-N-pyridin-1-ium-2-ylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4253119 |
| Molecular Formula | C21H17N4O3+ |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-oxo-N-pyridin-1-ium-2-ylphthalazine-1-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)Nc3cccc[nH+]3)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C21H16N4O3/c1-28-15-11-9-14(10-12-15)25-21(27)17-7-3-2-6-16(17)19(24-25)20(26)23-18-8-4-5-13-22-18/h2-13H,1H3,(H,22,23,26)/p+1 |
| InChIKey | WZUMNHQIBAMTEI-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |