C18H18N6O8 — CID 3961453
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate (PubChem CID 3961453) has the molecular formula C18H18N6O8 and a molecular weight of 446.38 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
|---|---|
| PubChem CID | 3961453 |
| Molecular Formula | C18H18N6O8 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N6O8/c1-21-16-15(17(27)22(2)18(21)28)23(9-19-16)7-14(26)32-8-13(25)20-11-5-4-10(31-3)6-12(11)24(29)30/h4-6,9H,7-8H2,1-3H3,(H,20,25) |
| InChIKey | ZFGMSLTVDCNLFU-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 169.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|