C19H20N2O7 — CID 7729363
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-phenoxybutanoate (PubChem CID 7729363) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-phenoxybutanoate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-phenoxybutanoate |
|---|---|
| PubChem CID | 7729363 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4-phenoxybutanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)CCCOc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H20N2O7/c1-26-15-9-10-16(17(12-15)21(24)25)20-18(22)13-28-19(23)8-5-11-27-14-6-3-2-4-7-14/h2-4,6-7,9-10,12H,5,8,11,13H2,1H3,(H,20,22) |
| InChIKey | ARJKIOBYCVCXOP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|