C20H22N2O7 — CID 7147870
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4-(4-methylphenoxy)butanoate (PubChem CID 7147870) has the molecular formula C20H22N2O7 and a molecular weight of 402.40 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4-(4-methylphenoxy)butanoate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4-(4-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7147870 |
| Molecular Formula | C20H22N2O7 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4-(4-methylphenoxy)butanoate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)CCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C20H22N2O7/c1-14-5-8-16(9-6-14)28-11-3-4-20(24)29-13-19(23)21-17-10-7-15(22(25)26)12-18(17)27-2/h5-10,12H,3-4,11,13H2,1-2H3,(H,21,23) |
| InChIKey | FOBFTEQMOYOUIF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|