C19H20N2O7S — CID 18228125
[2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate (PubChem CID 18228125) has the molecular formula C19H20N2O7S and a molecular weight of 420.44 g/mol. Its IUPAC name is [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate.
| Compound Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 18228125 |
| Molecular Formula | C19H20N2O7S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | [2-(2-methoxy-4-nitroanilino)-2-oxoethyl] 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)COC(=O)CCC(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C19H20N2O7S/c1-11-8-14(12(2)29-11)16(22)6-7-19(24)28-10-18(23)20-15-5-4-13(21(25)26)9-17(15)27-3/h4-5,8-9H,6-7,10H2,1-3H3,(H,20,23) |
| InChIKey | GEPGCYIWMCWQCX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|