C18H17ClN2O6S — CID 18226281
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate (PubChem CID 18226281) has the molecular formula C18H17ClN2O6S and a molecular weight of 424.86 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 18226281 |
| Molecular Formula | C18H17ClN2O6S |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate |
| SMILES | Cc1cc(C(=O)CCC(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c(C)s1 |
| InChI | InChI=1S/C18H17ClN2O6S/c1-10-7-13(11(2)28-10)16(22)5-6-18(24)27-9-17(23)20-15-4-3-12(21(25)26)8-14(15)19/h3-4,7-8H,5-6,9H2,1-2H3,(H,20,23) |
| InChIKey | JQIVTRLNVMWJOJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|