C19H17ClN2O7 — CID 31654745
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-(4-acetylphenoxy)propanoate (PubChem CID 31654745) has the molecular formula C19H17ClN2O7 and a molecular weight of 420.81 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-(4-acetylphenoxy)propanoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-(4-acetylphenoxy)propanoate |
|---|---|
| PubChem CID | 31654745 |
| Molecular Formula | C19H17ClN2O7 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-(4-acetylphenoxy)propanoate |
| SMILES | CC(=O)c1ccc(OCCC(=O)OCC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C19H17ClN2O7/c1-12(23)13-2-5-15(6-3-13)28-9-8-19(25)29-11-18(24)21-17-7-4-14(22(26)27)10-16(17)20/h2-7,10H,8-9,11H2,1H3,(H,21,24) |
| InChIKey | HMLKVWQWMAOMNI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|