C17H21ClN2O5 — CID 7840698
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-cyclohexylpropanoate (PubChem CID 7840698) has the molecular formula C17H21ClN2O5 and a molecular weight of 368.82 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-cyclohexylpropanoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 7840698 |
| Molecular Formula | C17H21ClN2O5 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-cyclohexylpropanoate |
| SMILES | O=C(COC(=O)CCC1CCCCC1)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H21ClN2O5/c18-14-10-13(20(23)24)7-8-15(14)19-16(21)11-25-17(22)9-6-12-4-2-1-3-5-12/h7-8,10,12H,1-6,9,11H2,(H,19,21) |
| InChIKey | MXYOQSKHPLYGFL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|