C18H24N2O6 — CID 4281873
[2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 3-cyclopentylpropanoate (PubChem CID 4281873) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is [2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 3-cyclopentylpropanoate.
| Compound Name | [2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 4281873 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [2-(4-ethoxy-2-nitroanilino)-2-oxoethyl] 3-cyclopentylpropanoate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)CCC2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24N2O6/c1-2-25-14-8-9-15(16(11-14)20(23)24)19-17(21)12-26-18(22)10-7-13-5-3-4-6-13/h8-9,11,13H,2-7,10,12H2,1H3,(H,19,21) |
| InChIKey | ZWJFBWHJOFJXCL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|