C14H14ClN3O6S — CID 55442805
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (PubChem CID 55442805) has the molecular formula C14H14ClN3O6S and a molecular weight of 387.80 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 55442805 |
| Molecular Formula | C14H14ClN3O6S |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| SMILES | O=C(COC(=O)CCN1CCSC1=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H14ClN3O6S/c15-10-7-9(18(22)23)1-2-11(10)16-12(19)8-24-13(20)3-4-17-5-6-25-14(17)21/h1-2,7H,3-6,8H2,(H,16,19) |
| InChIKey | PZWGKRYWHVIRIP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|