C13H12FN3O6S — CID 7632016
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 7632016) has the molecular formula C13H12FN3O6S and a molecular weight of 357.32 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 7632016 |
| Molecular Formula | C13H12FN3O6S |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | O=C(COC(=O)CN1CCSC1=O)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C13H12FN3O6S/c14-9-2-1-8(17(21)22)5-10(9)15-11(18)7-23-12(19)6-16-3-4-24-13(16)20/h1-2,5H,3-4,6-7H2,(H,15,18) |
| InChIKey | TVCXKXVEKFTBDU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|