C14H15FN2O4S — CID 9003515
[2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate (PubChem CID 9003515) has the molecular formula C14H15FN2O4S and a molecular weight of 326.35 g/mol. Its IUPAC name is [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate.
| Compound Name | [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
|---|---|
| PubChem CID | 9003515 |
| Molecular Formula | C14H15FN2O4S |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | [2-(2-fluoro-4-methylanilino)-2-oxoethyl] 2-(2-oxo-1,3-thiazolidin-3-yl)acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CN2CCSC2=O)c(F)c1 |
| InChI | InChI=1S/C14H15FN2O4S/c1-9-2-3-11(10(15)6-9)16-12(18)8-21-13(19)7-17-4-5-22-14(17)20/h2-3,6H,4-5,7-8H2,1H3,(H,16,18) |
| InChIKey | CCYNYCZPNRDQNZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|