C11H11FN2O2S — CID 9074397
N-(2-fluorophenyl)-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 9074397) has the molecular formula C11H11FN2O2S and a molecular weight of 254.29 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-(2-fluorophenyl)-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 9074397 |
| Molecular Formula | C11H11FN2O2S |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | N-(2-fluorophenyl)-2-(2-oxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | O=C(CN1CCSC1=O)Nc1ccccc1F |
| InChI | InChI=1S/C11H11FN2O2S/c12-8-3-1-2-4-9(8)13-10(15)7-14-5-6-17-11(14)16/h1-4H,5-7H2,(H,13,15) |
| InChIKey | MZUNTXNIYIIZQU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|