C14H16FN3O3 — CID 7190160
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(2-fluorophenyl)acetamide (PubChem CID 7190160) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7190160 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-(2-fluorophenyl)acetamide |
| SMILES | CCN1CCN(CC(=O)Nc2ccccc2F)C(=O)C1=O |
| InChI | InChI=1S/C14H16FN3O3/c1-2-17-7-8-18(14(21)13(17)20)9-12(19)16-11-6-4-3-5-10(11)15/h3-6H,2,7-9H2,1H3,(H,16,19) |
| InChIKey | PRKPWSZJJFAFCC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|