C17H16N2O2S — CID 9075405
2-(2-oxo-1,3-thiazolidin-3-yl)-N-(4-phenylphenyl)acetamide (PubChem CID 9075405) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 2-(2-oxo-1,3-thiazolidin-3-yl)-N-(4-phenylphenyl)acetamide.
| Compound Name | 2-(2-oxo-1,3-thiazolidin-3-yl)-N-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 9075405 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-(2-oxo-1,3-thiazolidin-3-yl)-N-(4-phenylphenyl)acetamide |
| SMILES | O=C(CN1CCSC1=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N2O2S/c20-16(12-19-10-11-22-17(19)21)18-15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-9H,10-12H2,(H,18,20) |
| InChIKey | GXEMPQSPWNHJEO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|