C15H15N5O4S2 — CID 39995775
2-(2-oxo-1,3-thiazolidin-3-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 39995775) has the molecular formula C15H15N5O4S2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-(2-oxo-1,3-thiazolidin-3-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(2-oxo-1,3-thiazolidin-3-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 39995775 |
| Molecular Formula | C15H15N5O4S2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 2-(2-oxo-1,3-thiazolidin-3-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CN1CCSC1=O)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C15H15N5O4S2/c21-13(10-20-8-9-25-15(20)22)18-11-2-4-12(5-3-11)26(23,24)19-14-16-6-1-7-17-14/h1-7H,8-10H2,(H,18,21)(H,16,17,19) |
| InChIKey | YWNPYRTUGMUDAE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|