C13H12N4O2S2 — CID 26708775
2-(2-oxo-1,3-thiazolidin-3-yl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 26708775) has the molecular formula C13H12N4O2S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 2-(2-oxo-1,3-thiazolidin-3-yl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(2-oxo-1,3-thiazolidin-3-yl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 26708775 |
| Molecular Formula | C13H12N4O2S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-(2-oxo-1,3-thiazolidin-3-yl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | O=C(CN1CCSC1=O)Nc1nnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C13H12N4O2S2/c18-10(8-17-6-7-20-13(17)19)14-12-16-15-11(21-12)9-4-2-1-3-5-9/h1-5H,6-8H2,(H,14,16,18) |
| InChIKey | UNWSAZJBNWVVGM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|