C12H13N3O3S — CID 47118630
2-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]benzamide (PubChem CID 47118630) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]benzamide.
| Compound Name | 2-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 47118630 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CN1CCSC1=O |
| InChI | InChI=1S/C12H13N3O3S/c13-11(17)8-3-1-2-4-9(8)14-10(16)7-15-5-6-19-12(15)18/h1-4H,5-7H2,(H2,13,17)(H,14,16) |
| InChIKey | WOQVIPMZOJWKDF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|