C16H20N4O3S — CID 24614147
3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]-4-pyrrolidin-1-ylbenzamide (PubChem CID 24614147) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 24614147 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]-4-pyrrolidin-1-ylbenzamide |
| SMILES | NC(=O)c1ccc(N2CCCC2)c(NC(=O)CN2CCSC2=O)c1 |
| InChI | InChI=1S/C16H20N4O3S/c17-15(22)11-3-4-13(19-5-1-2-6-19)12(9-11)18-14(21)10-20-7-8-24-16(20)23/h3-4,9H,1-2,5-8,10H2,(H2,17,22)(H,18,21) |
| InChIKey | UAJIYXKNZRVEID-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|