C20H27N5O4 — CID 55909801
3-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]-4-piperidin-1-ylbenzamide (PubChem CID 55909801) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]-4-piperidin-1-ylbenzamide.
| Compound Name | 3-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55909801 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]-4-piperidin-1-ylbenzamide |
| SMILES | CCN1CCN(CC(=O)Nc2cc(C(N)=O)ccc2N2CCCCC2)C(=O)C1=O |
| InChI | InChI=1S/C20H27N5O4/c1-2-23-10-11-25(20(29)19(23)28)13-17(26)22-15-12-14(18(21)27)6-7-16(15)24-8-4-3-5-9-24/h6-7,12H,2-5,8-11,13H2,1H3,(H2,21,27)(H,22,26) |
| InChIKey | RSMLSNKDKGRTQU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|