C22H21N3O5 — CID 25337602
methyl 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-pyrrolidin-1-ylbenzoate (PubChem CID 25337602) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is methyl 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-pyrrolidin-1-ylbenzoate.
| Compound Name | methyl 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 25337602 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | methyl 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-4-pyrrolidin-1-ylbenzoate |
| SMILES | COC(=O)c1ccc(N2CCCC2)c(NC(=O)CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C22H21N3O5/c1-30-22(29)14-8-9-18(24-10-4-5-11-24)17(12-14)23-19(26)13-25-20(27)15-6-2-3-7-16(15)21(25)28/h2-3,6-9,12H,4-5,10-11,13H2,1H3,(H,23,26) |
| InChIKey | ZUPCNUXWAJGFAL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|