C19H14Cl2N2O5 — CID 36930835
methyl 4-[[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]amino]-3-methylbenzoate (PubChem CID 36930835) has the molecular formula C19H14Cl2N2O5 and a molecular weight of 421.24 g/mol. Its IUPAC name is methyl 4-[[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]amino]-3-methylbenzoate.
| Compound Name | methyl 4-[[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 36930835 |
| Molecular Formula | C19H14Cl2N2O5 |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | methyl 4-[[2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetyl]amino]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)c(C)c1 |
| InChI | InChI=1S/C19H14Cl2N2O5/c1-9-5-10(19(27)28-2)3-4-15(9)22-16(24)8-23-17(25)11-6-13(20)14(21)7-12(11)18(23)26/h3-7H,8H2,1-2H3,(H,22,24) |
| InChIKey | NYACDMYTSSTIER-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|