C18H11Cl2N3O4 — CID 49183275
N-(5-cyano-2-methoxyphenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 49183275) has the molecular formula C18H11Cl2N3O4 and a molecular weight of 404.21 g/mol. Its IUPAC name is N-(5-cyano-2-methoxyphenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(5-cyano-2-methoxyphenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 49183275 |
| Molecular Formula | C18H11Cl2N3O4 |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | N-(5-cyano-2-methoxyphenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | COc1ccc(C#N)cc1NC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C18H11Cl2N3O4/c1-27-15-3-2-9(7-21)4-14(15)22-16(24)8-23-17(25)10-5-12(19)13(20)6-11(10)18(23)26/h2-6H,8H2,1H3,(H,22,24) |
| InChIKey | DAYFUNSNSFQUJE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|